C25H24NS+ — CID 90343205
3-(3,5-dimethyl-2,6-diphenylphenyl)-4,5-dimethyl-1,3-thiazol-3-ium (PubChem CID 90343205) has the molecular formula C25H24NS+ and a molecular weight of 370.54 g/mol. Its IUPAC name is 3-(3,5-dimethyl-2,6-diphenylphenyl)-4,5-dimethyl-1,3-thiazol-3-ium.
| Compound Name | 3-(3,5-dimethyl-2,6-diphenylphenyl)-4,5-dimethyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 90343205 |
| Molecular Formula | C25H24NS+ |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-(3,5-dimethyl-2,6-diphenylphenyl)-4,5-dimethyl-1,3-thiazol-3-ium |
| SMILES | Cc1cc(C)c(-c2ccccc2)c(-[n+]2csc(C)c2C)c1-c1ccccc1 |
| InChI | InChI=1S/C25H24NS/c1-17-15-18(2)24(22-13-9-6-10-14-22)25(26-16-27-20(4)19(26)3)23(17)21-11-7-5-8-12-21/h5-16H,1-4H3/q+1 |
| InChIKey | PZHOXXLFACIEAR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|