C20H22NS+ — CID 90342995
3-[2-(3,5-dimethylphenyl)-6-methylphenyl]-4,5-dimethyl-1,3-thiazol-3-ium (PubChem CID 90342995) has the molecular formula C20H22NS+ and a molecular weight of 308.47 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylphenyl)-6-methylphenyl]-4,5-dimethyl-1,3-thiazol-3-ium.
| Compound Name | 3-[2-(3,5-dimethylphenyl)-6-methylphenyl]-4,5-dimethyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 90342995 |
| Molecular Formula | C20H22NS+ |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 3-[2-(3,5-dimethylphenyl)-6-methylphenyl]-4,5-dimethyl-1,3-thiazol-3-ium |
| SMILES | Cc1cc(C)cc(-c2cccc(C)c2-[n+]2csc(C)c2C)c1 |
| InChI | InChI=1S/C20H22NS/c1-13-9-14(2)11-18(10-13)19-8-6-7-15(3)20(19)21-12-22-17(5)16(21)4/h6-12H,1-5H3/q+1 |
| InChIKey | BUDWKWLHWDEFPE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|