C17H20O4S — CID 10358650
[(1S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl] 4-methylbenzenesulfonate (PubChem CID 10358650) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is [(1S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10358650 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | [(1S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CCC3=CC(=O)CC[C@@]32C)cc1 |
| InChI | InChI=1S/C17H20O4S/c1-12-3-6-15(7-4-12)22(19,20)21-16-8-5-13-11-14(18)9-10-17(13,16)2/h3-4,6-7,11,16H,5,8-10H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | YWPXUQJGLVSIJA-IRXDYDNUSA-N |
| XLogP | 3.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|