C12H16ClN3 — CID 103606961
6-chloro-N-[2-(cyclohexen-1-yl)ethyl]pyrazin-2-amine (PubChem CID 103606961) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is 6-chloro-N-[2-(cyclohexen-1-yl)ethyl]pyrazin-2-amine.
| Compound Name | 6-chloro-N-[2-(cyclohexen-1-yl)ethyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 103606961 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 6-chloro-N-[2-(cyclohexen-1-yl)ethyl]pyrazin-2-amine |
| SMILES | Clc1cncc(NCCC2=CCCCC2)n1 |
| InChI | InChI=1S/C12H16ClN3/c13-11-8-14-9-12(16-11)15-7-6-10-4-2-1-3-5-10/h4,8-9H,1-3,5-7H2,(H,15,16) |
| InChIKey | UTQSMBHROUKDSG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|