C15H15FN3O10P — CID 10366324
[(2R,3R,4S,5R)-4-fluoro-3-hydroxy-5-[5-(2-nitrophenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 10366324) has the molecular formula C15H15FN3O10P and a molecular weight of 447.27 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-fluoro-3-hydroxy-5-[5-(2-nitrophenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-4-fluoro-3-hydroxy-5-[5-(2-nitrophenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10366324 |
| Molecular Formula | C15H15FN3O10P |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | [(2R,3R,4S,5R)-4-fluoro-3-hydroxy-5-[5-(2-nitrophenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H]2F)cc1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15FN3O10P/c16-11-12(20)10(6-28-30(25,26)27)29-14(11)18-5-8(13(21)17-15(18)22)7-3-1-2-4-9(7)19(23)24/h1-5,10-12,14,20H,6H2,(H,17,21,22)(H2,25,26,27)/t10-,11+,12-,14-/m1/s1 |
| InChIKey | SMGNRCTYXXROIW-GFQSEFKGSA-N |
| XLogP | -0.18 |
| TPSA | 194.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|