C23H26ClN7O2 — CID 10367335
(2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-cyanoimino-3-methylimidazolidin-1-yl)phenyl]pentanamide (PubChem CID 10367335) has the molecular formula C23H26ClN7O2 and a molecular weight of 467.96 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-cyanoimino-3-methylimidazolidin-1-yl)phenyl]pentanamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-cyanoimino-3-methylimidazolidin-1-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 10367335 |
| Molecular Formula | C23H26ClN7O2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-cyanoimino-3-methylimidazolidin-1-yl)phenyl]pentanamide |
| SMILES | CCC[C@@H](NC(=O)Nc1ccc(Cl)cc1)C(=O)Nc1ccc(N2CCN(C)/C2=N\C#N)cc1 |
| InChI | InChI=1S/C23H26ClN7O2/c1-3-4-20(29-22(33)28-18-7-5-16(24)6-8-18)21(32)27-17-9-11-19(12-10-17)31-14-13-30(2)23(31)26-15-25/h5-12,20H,3-4,13-14H2,1-2H3,(H,27,32)(H2,28,29,33)/b26-23+/t20-/m1/s1 |
| InChIKey | JTHQTXPWBSTAGY-UAPGPWSHSA-N |
| XLogP | 3.86 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|