C22H24ClN7O2 — CID 10253413
(2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-[2-(cyanoamino)-4,5-dihydroimidazol-1-yl]phenyl]pentanamide (PubChem CID 10253413) has the molecular formula C22H24ClN7O2 and a molecular weight of 453.93 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-[2-(cyanoamino)-4,5-dihydroimidazol-1-yl]phenyl]pentanamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-[2-(cyanoamino)-4,5-dihydroimidazol-1-yl]phenyl]pentanamide |
|---|---|
| PubChem CID | 10253413 |
| Molecular Formula | C22H24ClN7O2 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-[2-(cyanoamino)-4,5-dihydroimidazol-1-yl]phenyl]pentanamide |
| SMILES | CCC[C@@H](NC(=O)Nc1ccc(Cl)cc1)C(=O)Nc1ccc(N2CCN=C2NC#N)cc1 |
| InChI | InChI=1S/C22H24ClN7O2/c1-2-3-19(29-22(32)28-17-6-4-15(23)5-7-17)20(31)27-16-8-10-18(11-9-16)30-13-12-25-21(30)26-14-24/h4-11,19H,2-3,12-13H2,1H3,(H,25,26)(H,27,31)(H2,28,29,32)/t19-/m1/s1 |
| InChIKey | AYDDNOKNQXCDFC-LJQANCHMSA-N |
| XLogP | 3.52 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|