C24H24ClN9O2 — CID 10368896
(2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-[2-(cyanoamino)-4,5-dihydroimidazol-1-yl]phenyl]-3-(1-methylimidazol-4-yl)propanamide (PubChem CID 10368896) has the molecular formula C24H24ClN9O2 and a molecular weight of 505.97 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-[2-(cyanoamino)-4,5-dihydroimidazol-1-yl]phenyl]-3-(1-methylimidazol-4-yl)propanamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-[2-(cyanoamino)-4,5-dihydroimidazol-1-yl]phenyl]-3-(1-methylimidazol-4-yl)propanamide |
|---|---|
| PubChem CID | 10368896 |
| Molecular Formula | C24H24ClN9O2 |
| Molecular Weight | 505.97 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-[2-(cyanoamino)-4,5-dihydroimidazol-1-yl]phenyl]-3-(1-methylimidazol-4-yl)propanamide |
| SMILES | Cn1cnc(C[C@@H](NC(=O)Nc2ccc(Cl)cc2)C(=O)Nc2ccc(N3CCN=C3NC#N)cc2)c1 |
| InChI | InChI=1S/C24H24ClN9O2/c1-33-13-19(29-15-33)12-21(32-24(36)31-18-4-2-16(25)3-5-18)22(35)30-17-6-8-20(9-7-17)34-11-10-27-23(34)28-14-26/h2-9,13,15,21H,10-12H2,1H3,(H,27,28)(H,30,35)(H2,31,32,36)/t21-/m1/s1 |
| InChIKey | QENUDJUOJOMDNX-OAQYLSRUSA-N |
| XLogP | 2.69 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.97 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|