C15H27F3N2O3 — CID 103695799
tert-butyl N-[[2-[2-(2,2,2-trifluoroethoxy)ethylamino]cyclopentyl]methyl]carbamate (PubChem CID 103695799) has the molecular formula C15H27F3N2O3 and a molecular weight of 340.39 g/mol. Its IUPAC name is tert-butyl N-[[2-[2-(2,2,2-trifluoroethoxy)ethylamino]cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[2-(2,2,2-trifluoroethoxy)ethylamino]cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 103695799 |
| Molecular Formula | C15H27F3N2O3 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | tert-butyl N-[[2-[2-(2,2,2-trifluoroethoxy)ethylamino]cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC1NCCOCC(F)(F)F |
| InChI | InChI=1S/C15H27F3N2O3/c1-14(2,3)23-13(21)20-9-11-5-4-6-12(11)19-7-8-22-10-15(16,17)18/h11-12,19H,4-10H2,1-3H3,(H,20,21) |
| InChIKey | ISIDGGZSNGXEBP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|