C29H46O5Si2 — CID 10369738
(1S,2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-[(2R)-oxiran-2-yl]butane-1,3-diol (PubChem CID 10369738) has the molecular formula C29H46O5Si2 and a molecular weight of 530.85 g/mol. Its IUPAC name is (1S,2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-[(2R)-oxiran-2-yl]butane-1,3-diol.
| Compound Name | (1S,2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-[(2R)-oxiran-2-yl]butane-1,3-diol |
|---|---|
| PubChem CID | 10369738 |
| Molecular Formula | C29H46O5Si2 |
| Molecular Weight | 530.85 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | (1S,2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-2-methyl-1-[(2R)-oxiran-2-yl]butane-1,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@](C)(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](O)[C@H]1CO1 |
| InChI | InChI=1S/C29H46O5Si2/c1-27(2,3)35(8,9)33-21-25(30)29(7,26(31)24-20-32-24)34-36(28(4,5)6,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h10-19,24-26,30-31H,20-21H2,1-9H3/t24-,25-,26+,29+/m1/s1 |
| InChIKey | NTRKGVTYEYPYCN-JMDODURXSA-N |
| XLogP | 4.46 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.85 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|