C11H24N5O5PPt — CID 10369770
(2S)-2-[[amino(hydroxy)phosphinimyl]amino]pentanedioate;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine (PubChem CID 10369770) has the molecular formula C11H24N5O5PPt and a molecular weight of 532.40 g/mol. Its IUPAC name is (2S)-2-[[amino(hydroxy)phosphinimyl]amino]pentanedioate;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine.
| Compound Name | (2S)-2-[[amino(hydroxy)phosphinimyl]amino]pentanedioate;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 10369770 |
| Molecular Formula | C11H24N5O5PPt |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | (2S)-2-[[amino(hydroxy)phosphinimyl]amino]pentanedioate;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@H]1N.[H]N=P(N)(O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Pt+2] |
| InChI | InChI=1S/C6H14N2.C5H12N3O5P.Pt/c7-5-3-1-2-4-6(5)8;6-14(7,13)8-3(5(11)12)1-2-4(9)10;/h5-6H,1-4,7-8H2;3H,1-2H2,(H,9,10)(H,11,12)(H5,6,7,8,13);/q;;+2/p-2/t5-,6-;3-;/m10./s1 |
| InChIKey | VLAVTBJXPSEVEY-YSKOBYGBSA-L |
| XLogP | -3.09 |
| TPSA | 214.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|