C13H25N3O4Pt — CID 71481438
cyclohexane-1,2-diamine;2-[2-(ethylamino)ethyl]propanedioate;platinum(2+) (PubChem CID 71481438) has the molecular formula C13H25N3O4Pt and a molecular weight of 482.44 g/mol. Its IUPAC name is cyclohexane-1,2-diamine;2-[2-(ethylamino)ethyl]propanedioate;platinum(2+).
| Compound Name | cyclohexane-1,2-diamine;2-[2-(ethylamino)ethyl]propanedioate;platinum(2+) |
|---|---|
| PubChem CID | 71481438 |
| Molecular Formula | C13H25N3O4Pt |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | cyclohexane-1,2-diamine;2-[2-(ethylamino)ethyl]propanedioate;platinum(2+) |
| SMILES | CCNCCC(C(=O)[O-])C(=O)[O-].NC1CCCCC1N.[Pt+2] |
| InChI | InChI=1S/C7H13NO4.C6H14N2.Pt/c1-2-8-4-3-5(6(9)10)7(11)12;7-5-3-1-2-4-6(5)8;/h5,8H,2-4H2,1H3,(H,9,10)(H,11,12);5-6H,1-4,7-8H2;/q;;+2/p-2 |
| InChIKey | GBHUOZKHKLAOES-UHFFFAOYSA-L |
| XLogP | -2.69 |
| TPSA | 144.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|