C29H36N6O7S2 — CID 10372007
methyl (2S)-6-amino-2-[[(2S)-2-[[2-(ethylcarbamoylsulfanyl)acetyl]amino]-3-[2-(2-nitrophenyl)sulfanyl-1H-indol-3-yl]propanoyl]amino]hexanoate (PubChem CID 10372007) has the molecular formula C29H36N6O7S2 and a molecular weight of 644.78 g/mol. Its IUPAC name is methyl (2S)-6-amino-2-[[(2S)-2-[[2-(ethylcarbamoylsulfanyl)acetyl]amino]-3-[2-(2-nitrophenyl)sulfanyl-1H-indol-3-yl]propanoyl]amino]hexanoate.
| Compound Name | methyl (2S)-6-amino-2-[[(2S)-2-[[2-(ethylcarbamoylsulfanyl)acetyl]amino]-3-[2-(2-nitrophenyl)sulfanyl-1H-indol-3-yl]propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 10372007 |
| Molecular Formula | C29H36N6O7S2 |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | methyl (2S)-6-amino-2-[[(2S)-2-[[2-(ethylcarbamoylsulfanyl)acetyl]amino]-3-[2-(2-nitrophenyl)sulfanyl-1H-indol-3-yl]propanoyl]amino]hexanoate |
| SMILES | CCNC(=O)SCC(=O)N[C@@H](Cc1c(Sc2ccccc2[N+](=O)[O-])[nH]c2ccccc12)C(=O)N[C@@H](CCCCN)C(=O)OC |
| InChI | InChI=1S/C29H36N6O7S2/c1-3-31-29(39)43-17-25(36)32-22(26(37)33-21(28(38)42-2)12-8-9-15-30)16-19-18-10-4-5-11-20(18)34-27(19)44-24-14-7-6-13-23(24)35(40)41/h4-7,10-11,13-14,21-22,34H,3,8-9,12,15-17,30H2,1-2H3,(H,31,39)(H,32,36)(H,33,37)/t21-,22-/m0/s1 |
| InChIKey | LTPLLAOOKHATAP-VXKWHMMOSA-N |
| XLogP | 3.50 |
| TPSA | 198.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|