C13H22N2O2S2 — CID 103725485
N-[2-(2-hydroxyethyl)pentyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide (PubChem CID 103725485) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.46 g/mol. Its IUPAC name is N-[2-(2-hydroxyethyl)pentyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[2-(2-hydroxyethyl)pentyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 103725485 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[2-(2-hydroxyethyl)pentyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
| SMILES | CCCC(CCO)CNC(=O)Cc1sc(=S)[nH]c1C |
| InChI | InChI=1S/C13H22N2O2S2/c1-3-4-10(5-6-16)8-14-12(17)7-11-9(2)15-13(18)19-11/h10,16H,3-8H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | QBOUNRUHPOMKRK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|