C13H20ClN3O2S — CID 103798852
(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide (PubChem CID 103798852) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 103798852 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide |
| SMILES | CSC(CO)C(C)NC(=O)/C=C/c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C13H20ClN3O2S/c1-8-10(13(14)17(3)16-8)5-6-12(19)15-9(2)11(7-18)20-4/h5-6,9,11,18H,7H2,1-4H3,(H,15,19)/b6-5+ |
| InChIKey | PMQYFXREQIBXGF-AATRIKPKSA-N |
| XLogP | 1.62 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|