C18H30N2O4 — CID 10382513
[2-hydroxy-3-(propylamino)propyl] N-(3-pentoxyphenyl)carbamate (PubChem CID 10382513) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is [2-hydroxy-3-(propylamino)propyl] N-(3-pentoxyphenyl)carbamate.
| Compound Name | [2-hydroxy-3-(propylamino)propyl] N-(3-pentoxyphenyl)carbamate |
|---|---|
| PubChem CID | 10382513 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | [2-hydroxy-3-(propylamino)propyl] N-(3-pentoxyphenyl)carbamate |
| SMILES | CCCCCOc1cccc(NC(=O)OCC(O)CNCCC)c1 |
| InChI | InChI=1S/C18H30N2O4/c1-3-5-6-11-23-17-9-7-8-15(12-17)20-18(22)24-14-16(21)13-19-10-4-2/h7-9,12,16,19,21H,3-6,10-11,13-14H2,1-2H3,(H,20,22) |
| InChIKey | IFFYPSXLNZFFPS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|