C25H34O3 — CID 10385257
4-[(E)-8-(3,5-dimethoxyphenyl)-5-methyloct-5-enyl]-2,6-dimethylphenol (PubChem CID 10385257) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is 4-[(E)-8-(3,5-dimethoxyphenyl)-5-methyloct-5-enyl]-2,6-dimethylphenol.
| Compound Name | 4-[(E)-8-(3,5-dimethoxyphenyl)-5-methyloct-5-enyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 10385257 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 4-[(E)-8-(3,5-dimethoxyphenyl)-5-methyloct-5-enyl]-2,6-dimethylphenol |
| SMILES | COc1cc(CC/C=C(\C)CCCCc2cc(C)c(O)c(C)c2)cc(OC)c1 |
| InChI | InChI=1S/C25H34O3/c1-18(9-6-7-11-21-13-19(2)25(26)20(3)14-21)10-8-12-22-15-23(27-4)17-24(16-22)28-5/h10,13-17,26H,6-9,11-12H2,1-5H3/b18-10+ |
| InChIKey | OZBNJKPRGZIEBU-VCHYOVAHSA-N |
| XLogP | 6.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|