C11H10ClN3O3S — CID 103888758
2-[(6-chloro-4-nitro-2-pyridinyl)amino]-1-thiophen-3-ylethanol (PubChem CID 103888758) has the molecular formula C11H10ClN3O3S and a molecular weight of 299.74 g/mol. Its IUPAC name is 2-[(6-chloro-4-nitro-2-pyridinyl)amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(6-chloro-4-nitro-2-pyridinyl)amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 103888758 |
| Molecular Formula | C11H10ClN3O3S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2-[(6-chloro-4-nitro-2-pyridinyl)amino]-1-thiophen-3-ylethanol |
| SMILES | O=[N+]([O-])c1cc(Cl)nc(NCC(O)c2ccsc2)c1 |
| InChI | InChI=1S/C11H10ClN3O3S/c12-10-3-8(15(17)18)4-11(14-10)13-5-9(16)7-1-2-19-6-7/h1-4,6,9,16H,5H2,(H,13,14) |
| InChIKey | IKFISTWRYABZFZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|