C26H28F3N3O4 — CID 10391390
1,5-dimethyl-5-phenyl-3-[4-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]butyl]imidazolidine-2,4-dione (PubChem CID 10391390) has the molecular formula C26H28F3N3O4 and a molecular weight of 503.52 g/mol. Its IUPAC name is 1,5-dimethyl-5-phenyl-3-[4-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]butyl]imidazolidine-2,4-dione.
| Compound Name | 1,5-dimethyl-5-phenyl-3-[4-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]butyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10391390 |
| Molecular Formula | C26H28F3N3O4 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 1,5-dimethyl-5-phenyl-3-[4-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]butyl]imidazolidine-2,4-dione |
| SMILES | CCCc1c(OCCCCN2C(=O)N(C)C(C)(c3ccccc3)C2=O)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C26H28F3N3O4/c1-4-10-18-20(14-13-19-21(18)36-30-22(19)26(27,28)29)35-16-9-8-15-32-23(33)25(2,31(3)24(32)34)17-11-6-5-7-12-17/h5-7,11-14H,4,8-10,15-16H2,1-3H3 |
| InChIKey | CNNROFJKQRGHNE-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|