C16H26O5 — CID 10402427
[(3aR,6aR)-4-octyl-6-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl] acetate (PubChem CID 10402427) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is [(3aR,6aR)-4-octyl-6-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl] acetate.
| Compound Name | [(3aR,6aR)-4-octyl-6-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl] acetate |
|---|---|
| PubChem CID | 10402427 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [(3aR,6aR)-4-octyl-6-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-c]furan-2-yl] acetate |
| SMILES | CCCCCCCCC1OC(=O)[C@@H]2OC(OC(C)=O)C[C@H]12 |
| InChI | InChI=1S/C16H26O5/c1-3-4-5-6-7-8-9-13-12-10-14(19-11(2)17)21-15(12)16(18)20-13/h12-15H,3-10H2,1-2H3/t12-,13?,14?,15-/m1/s1 |
| InChIKey | UKHKFFICCLFRIU-XSCHDIRWSA-N |
| XLogP | 2.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|