C24H29F3O3S — CID 10411656
[(2R)-1-phenylsulfanyloctan-2-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10411656) has the molecular formula C24H29F3O3S and a molecular weight of 454.55 g/mol. Its IUPAC name is [(2R)-1-phenylsulfanyloctan-2-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2R)-1-phenylsulfanyloctan-2-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10411656 |
| Molecular Formula | C24H29F3O3S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | [(2R)-1-phenylsulfanyloctan-2-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCCC[C@H](CSc1ccccc1)OC(=O)C(OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H29F3O3S/c1-3-4-5-10-15-20(18-31-21-16-11-7-12-17-21)30-22(28)23(29-2,24(25,26)27)19-13-8-6-9-14-19/h6-9,11-14,16-17,20H,3-5,10,15,18H2,1-2H3/t20-,23?/m1/s1 |
| InChIKey | RGDZQIGDFFHRNZ-PPUHSXQSSA-N |
| XLogP | 6.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|