About ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate
ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate (PubChem CID 10411865) has the molecular formula C22H16Cl2N2O5
and a molecular weight of 459.29 g/mol. Its IUPAC name is ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate.
Molecular Properties
| Compound Name | ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate |
| PubChem CID | 10411865 |
| Molecular Formula | C22H16Cl2N2O5 |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate |
| SMILES | CCOC(=O)COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)c2c1oc1ccccc12 |
| InChI | InChI=1S/C22H16Cl2N2O5/c1-2-29-18(27)11-30-17-8-7-13(19-12-5-3-4-6-16(12)31-21(17)19)22(28)26-20-14(23)9-25-10-15(20)24/h3-10H,2,11H2,1H3,(H,25,26,28) |
| InChIKey | KCUDXHWRLNWGNE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate?
The IUPAC name of ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate (CID 10411865) is ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate.
What is the SMILES notation for ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate?
The canonical SMILES for ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate is CCOC(=O)COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)c2c1oc1ccccc12.
What is the InChIKey of ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate?
The InChIKey is KCUDXHWRLNWGNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Cl2N2O5/c1-2-29-18(27)11-30-17-8-7-13(19-12-5-3-4-6-16(12)31-21(17)19)22(28)26-20-14(23)9-25-10-15(20)24/h3-10H,2,11H2,1H3,(H,25,26,28).
What are the key properties of ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate?
ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate has a molecular weight of 459.29 g/mol, XLogP of 5.48, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1-[(3,5-dichloro-4-pyridinyl)carbamoyl]dibenzofuran-4-yl]oxyacetate is sourced from PubChem (CID 10411865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).