C29H50O3SSi — CID 10413886
(1R,2R)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-1-phenyl-2-tri(propan-2-yl)silyloxypropan-1-ol (PubChem CID 10413886) has the molecular formula C29H50O3SSi and a molecular weight of 506.87 g/mol. Its IUPAC name is (1R,2R)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-1-phenyl-2-tri(propan-2-yl)silyloxypropan-1-ol.
| Compound Name | (1R,2R)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-1-phenyl-2-tri(propan-2-yl)silyloxypropan-1-ol |
|---|---|
| PubChem CID | 10413886 |
| Molecular Formula | C29H50O3SSi |
| Molecular Weight | 506.87 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | (1R,2R)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-1-phenyl-2-tri(propan-2-yl)silyloxypropan-1-ol |
| SMILES | CC(C)[Si](O[C@H](C)[C@](O)(c1ccccc1)[C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)S1)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H50O3SSi/c1-19(2)34(20(3)4,21(5)6)32-23(8)29(30,24-14-12-11-13-15-24)27-31-26-18-22(7)16-17-25(26)28(9,10)33-27/h11-15,19-23,25-27,30H,16-18H2,1-10H3/t22-,23-,25-,26-,27-,29+/m1/s1 |
| InChIKey | OBEZJPPRHMSGEA-XEHZGKOZSA-N |
| XLogP | 8.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.87 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|