C20H30O2S — CID 134872766
(2R)-2-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-1-phenylpropan-2-ol (PubChem CID 134872766) has the molecular formula C20H30O2S and a molecular weight of 334.52 g/mol. Its IUPAC name is (2R)-2-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-1-phenylpropan-2-ol.
| Compound Name | (2R)-2-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-1-phenylpropan-2-ol |
|---|---|
| PubChem CID | 134872766 |
| Molecular Formula | C20H30O2S |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (2R)-2-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-1-phenylpropan-2-ol |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H]([C@](C)(O)Cc1ccccc1)SC2(C)C |
| InChI | InChI=1S/C20H30O2S/c1-14-10-11-16-17(12-14)22-18(23-19(16,2)3)20(4,21)13-15-8-6-5-7-9-15/h5-9,14,16-18,21H,10-13H2,1-4H3/t14-,16-,17-,18-,20-/m1/s1 |
| InChIKey | VHMWSGLRTWOASN-JQLJIJSLSA-N |
| XLogP | 4.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |