C23H37NOS — CID 10904881
(1R)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-N-benzylpentan-1-amine (PubChem CID 10904881) has the molecular formula C23H37NOS and a molecular weight of 375.62 g/mol. Its IUPAC name is (1R)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-N-benzylpentan-1-amine.
| Compound Name | (1R)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-N-benzylpentan-1-amine |
|---|---|
| PubChem CID | 10904881 |
| Molecular Formula | C23H37NOS |
| Molecular Weight | 375.62 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | (1R)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-N-benzylpentan-1-amine |
| SMILES | CCCC[C@@H](NCc1ccccc1)[C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)S1 |
| InChI | InChI=1S/C23H37NOS/c1-5-6-12-20(24-16-18-10-8-7-9-11-18)22-25-21-15-17(2)13-14-19(21)23(3,4)26-22/h7-11,17,19-22,24H,5-6,12-16H2,1-4H3/t17-,19-,20-,21-,22-/m1/s1 |
| InChIKey | ARHBKPZKKJBYGC-MSEOUXRUSA-N |
| XLogP | 6.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |