C19H26O2S — CID 11723439
1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-phenylethanone (PubChem CID 11723439) has the molecular formula C19H26O2S and a molecular weight of 318.48 g/mol. Its IUPAC name is 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-phenylethanone.
| Compound Name | 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 11723439 |
| Molecular Formula | C19H26O2S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-phenylethanone |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](C(=O)Cc1ccccc1)SC2(C)C |
| InChI | InChI=1S/C19H26O2S/c1-13-9-10-15-17(11-13)21-18(22-19(15,2)3)16(20)12-14-7-5-4-6-8-14/h4-8,13,15,17-18H,9-12H2,1-3H3/t13-,15-,17-,18-/m1/s1 |
| InChIKey | QTUYKCKKIQZTPU-MOIQIXESSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |