C25H40F3NO2Si — CID 11712540
[(2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorobutan-2-yl]oxy-trimethylsilane (PubChem CID 11712540) has the molecular formula C25H40F3NO2Si and a molecular weight of 471.68 g/mol. Its IUPAC name is [(2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorobutan-2-yl]oxy-trimethylsilane.
| Compound Name | [(2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorobutan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11712540 |
| Molecular Formula | C25H40F3NO2Si |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | [(2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluorobutan-2-yl]oxy-trimethylsilane |
| SMILES | CC[C@](O[Si](C)(C)C)([C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H40F3NO2Si/c1-8-24(25(26,27)28,31-32(5,6)7)22-29(17-19-12-10-9-11-13-19)23(3,4)20-15-14-18(2)16-21(20)30-22/h9-13,18,20-22H,8,14-17H2,1-7H3/t18-,20-,21-,22+,24+/m1/s1 |
| InChIKey | DXAVYCXGQPLMJQ-CKPWDMNVSA-N |
| XLogP | 6.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|