C22H26O2 — CID 10426295
2,2-bis(2,4,6-trimethylphenyl)ethenyl acetate (PubChem CID 10426295) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2,2-bis(2,4,6-trimethylphenyl)ethenyl acetate.
| Compound Name | 2,2-bis(2,4,6-trimethylphenyl)ethenyl acetate |
|---|---|
| PubChem CID | 10426295 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2,2-bis(2,4,6-trimethylphenyl)ethenyl acetate |
| SMILES | CC(=O)OC=C(c1c(C)cc(C)cc1C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H26O2/c1-13-8-15(3)21(16(4)9-13)20(12-24-19(7)23)22-17(5)10-14(2)11-18(22)6/h8-12H,1-7H3 |
| InChIKey | QPKQGKGBPVMNEI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|