C18H18N2O4 — CID 10426523
3-amino-5,6,7-trimethoxy-2-(pyridin-4-ylmethyl)inden-1-one (PubChem CID 10426523) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-amino-5,6,7-trimethoxy-2-(pyridin-4-ylmethyl)inden-1-one.
| Compound Name | 3-amino-5,6,7-trimethoxy-2-(pyridin-4-ylmethyl)inden-1-one |
|---|---|
| PubChem CID | 10426523 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-amino-5,6,7-trimethoxy-2-(pyridin-4-ylmethyl)inden-1-one |
| SMILES | COc1cc2c(c(OC)c1OC)C(=O)C(Cc1ccncc1)=C2N |
| InChI | InChI=1S/C18H18N2O4/c1-22-13-9-11-14(18(24-3)17(13)23-2)16(21)12(15(11)19)8-10-4-6-20-7-5-10/h4-7,9H,8,19H2,1-3H3 |
| InChIKey | IVHLBAHHZSBJRM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |