C17H19N3O4S — CID 18374632
6,7-dimethoxy-2-methylsulfonyl-4-(pyridin-4-ylmethyl)-1H-phthalazine (PubChem CID 18374632) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methylsulfonyl-4-(pyridin-4-ylmethyl)-1H-phthalazine.
| Compound Name | 6,7-dimethoxy-2-methylsulfonyl-4-(pyridin-4-ylmethyl)-1H-phthalazine |
|---|---|
| PubChem CID | 18374632 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 6,7-dimethoxy-2-methylsulfonyl-4-(pyridin-4-ylmethyl)-1H-phthalazine |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccncc1)=NN(S(C)(=O)=O)C2 |
| InChI | InChI=1S/C17H19N3O4S/c1-23-16-9-13-11-20(25(3,21)22)19-15(14(13)10-17(16)24-2)8-12-4-6-18-7-5-12/h4-7,9-10H,8,11H2,1-3H3 |
| InChIKey | VANRLCSAMDYZAA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |