C20H28O5 — CID 10427845
(3R,4R)-4-[(4R,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-4-methyl-3-phenylmethoxyoxolan-2-one (PubChem CID 10427845) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (3R,4R)-4-[(4R,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-4-methyl-3-phenylmethoxyoxolan-2-one.
| Compound Name | (3R,4R)-4-[(4R,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-4-methyl-3-phenylmethoxyoxolan-2-one |
|---|---|
| PubChem CID | 10427845 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (3R,4R)-4-[(4R,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-4-methyl-3-phenylmethoxyoxolan-2-one |
| SMILES | CC[C@H]1OC(C)(C)O[C@]1(C)[C@]1(C)COC(=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H28O5/c1-6-15-20(5,25-18(2,3)24-15)19(4)13-23-17(21)16(19)22-12-14-10-8-7-9-11-14/h7-11,15-16H,6,12-13H2,1-5H3/t15-,16+,19-,20+/m1/s1 |
| InChIKey | BZPRGMGABONNJS-GJJHYRHESA-N |
| XLogP | 3.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |