C23H27N3O3 — CID 10430684
N-benzyl-3,3-diethyl-2-oxo-4-[(E)-1-phenylethylideneamino]oxyazetidine-1-carboxamide (PubChem CID 10430684) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-benzyl-3,3-diethyl-2-oxo-4-[(E)-1-phenylethylideneamino]oxyazetidine-1-carboxamide.
| Compound Name | N-benzyl-3,3-diethyl-2-oxo-4-[(E)-1-phenylethylideneamino]oxyazetidine-1-carboxamide |
|---|---|
| PubChem CID | 10430684 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-benzyl-3,3-diethyl-2-oxo-4-[(E)-1-phenylethylideneamino]oxyazetidine-1-carboxamide |
| SMILES | CCC1(CC)C(=O)N(C(=O)NCc2ccccc2)C1O/N=C(\C)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O3/c1-4-23(5-2)20(27)26(22(28)24-16-18-12-8-6-9-13-18)21(23)29-25-17(3)19-14-10-7-11-15-19/h6-15,21H,4-5,16H2,1-3H3,(H,24,28)/b25-17+ |
| InChIKey | XKKFZVYZYDZWEN-KOEQRZSOSA-N |
| XLogP | 4.31 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|