C35H34N2O3 — CID 10437036
N-[(1S,5R)-3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-azabicyclo[3.1.0]hexan-6-yl]-3,3,3-triphenylpropanamide (PubChem CID 10437036) has the molecular formula C35H34N2O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is N-[(1S,5R)-3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-azabicyclo[3.1.0]hexan-6-yl]-3,3,3-triphenylpropanamide.
| Compound Name | N-[(1S,5R)-3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-azabicyclo[3.1.0]hexan-6-yl]-3,3,3-triphenylpropanamide |
|---|---|
| PubChem CID | 10437036 |
| Molecular Formula | C35H34N2O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | N-[(1S,5R)-3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-azabicyclo[3.1.0]hexan-6-yl]-3,3,3-triphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)(c1ccccc1)c1ccccc1)NC1[C@H]2CN(CCc3ccc4c(c3)OCO4)C[C@@H]12 |
| InChI | InChI=1S/C35H34N2O3/c38-33(36-34-29-22-37(23-30(29)34)19-18-25-16-17-31-32(20-25)40-24-39-31)21-35(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-17,20,29-30,34H,18-19,21-24H2,(H,36,38)/t29-,30+,34? |
| InChIKey | NXOAFQQKBUWPHU-PXWABBFCSA-N |
| XLogP | 5.43 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|