C31H35IN2O3 — CID 25117523
3-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-3-azoniabicyclo[3.1.0]hexan-6-yl]-2,2-diphenylpropanamide iodide (PubChem CID 25117523) has the molecular formula C31H35IN2O3 and a molecular weight of 610.54 g/mol. Its IUPAC name is 3-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-3-azoniabicyclo[3.1.0]hexan-6-yl]-2,2-diphenylpropanamide iodide.
| Compound Name | 3-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-3-azoniabicyclo[3.1.0]hexan-6-yl]-2,2-diphenylpropanamide iodide |
|---|---|
| PubChem CID | 25117523 |
| Molecular Formula | C31H35IN2O3 |
| Molecular Weight | 610.54 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | 3-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-3-azoniabicyclo[3.1.0]hexan-6-yl]-2,2-diphenylpropanamide iodide |
| SMILES | CC[N+]1(CCc2ccc3c(c2)OCO3)CC2C(CC(C(N)=O)(c3ccccc3)c3ccccc3)C2C1.[I-] |
| InChI | InChI=1S/C31H34N2O3.HI/c1-2-33(16-15-22-13-14-28-29(17-22)36-21-35-28)19-26-25(27(26)20-33)18-31(30(32)34,23-9-5-3-6-10-23)24-11-7-4-8-12-24;/h3-14,17,25-27H,2,15-16,18-21H2,1H3,(H-,32,34);1H |
| InChIKey | XIGCBVXVDZOQGQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.54 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|