C26H27NO3 — CID 155041320
(4S)-1-(1,3-benzodioxol-5-yl)-4-(dimethylamino)-2,2-diphenylpentan-1-one (PubChem CID 155041320) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is (4S)-1-(1,3-benzodioxol-5-yl)-4-(dimethylamino)-2,2-diphenylpentan-1-one.
| Compound Name | (4S)-1-(1,3-benzodioxol-5-yl)-4-(dimethylamino)-2,2-diphenylpentan-1-one |
|---|---|
| PubChem CID | 155041320 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (4S)-1-(1,3-benzodioxol-5-yl)-4-(dimethylamino)-2,2-diphenylpentan-1-one |
| SMILES | C[C@@H](CC(C(=O)c1ccc2c(c1)OCO2)(c1ccccc1)c1ccccc1)N(C)C |
| InChI | InChI=1S/C26H27NO3/c1-19(27(2)3)17-26(21-10-6-4-7-11-21,22-12-8-5-9-13-22)25(28)20-14-15-23-24(16-20)30-18-29-23/h4-16,19H,17-18H2,1-3H3/t19-/m0/s1 |
| InChIKey | MYMPTFRVIRSSJZ-IBGZPJMESA-N |
| XLogP | 4.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |