C14H20NO3+ — CID 54183180
[1-[2-(1,3-benzodioxol-5-yl)ethyl]pyrrolidin-1-ium-1-yl]methanol (PubChem CID 54183180) has the molecular formula C14H20NO3+ and a molecular weight of 250.32 g/mol. Its IUPAC name is [1-[2-(1,3-benzodioxol-5-yl)ethyl]pyrrolidin-1-ium-1-yl]methanol.
| Compound Name | [1-[2-(1,3-benzodioxol-5-yl)ethyl]pyrrolidin-1-ium-1-yl]methanol |
|---|---|
| PubChem CID | 54183180 |
| Molecular Formula | C14H20NO3+ |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | [1-[2-(1,3-benzodioxol-5-yl)ethyl]pyrrolidin-1-ium-1-yl]methanol |
| SMILES | OC[N+]1(CCc2ccc3c(c2)OCO3)CCCC1 |
| InChI | InChI=1S/C14H20NO3/c16-10-15(6-1-2-7-15)8-5-12-3-4-13-14(9-12)18-11-17-13/h3-4,9,16H,1-2,5-8,10-11H2/q+1 |
| InChIKey | JBEGKURIBPUDRF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|