C32H35IN2O2 — CID 25118239
5-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-methyl-3-azoniabicyclo[3.1.0]hexan-6-yl]-2,2-diphenylpentanenitrile iodide (PubChem CID 25118239) has the molecular formula C32H35IN2O2 and a molecular weight of 606.55 g/mol. Its IUPAC name is 5-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-methyl-3-azoniabicyclo[3.1.0]hexan-6-yl]-2,2-diphenylpentanenitrile iodide.
| Compound Name | 5-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-methyl-3-azoniabicyclo[3.1.0]hexan-6-yl]-2,2-diphenylpentanenitrile iodide |
|---|---|
| PubChem CID | 25118239 |
| Molecular Formula | C32H35IN2O2 |
| Molecular Weight | 606.55 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | 5-[3-[2-(1,3-benzodioxol-5-yl)ethyl]-3-methyl-3-azoniabicyclo[3.1.0]hexan-6-yl]-2,2-diphenylpentanenitrile iodide |
| SMILES | C[N+]1(CCc2ccc3c(c2)OCO3)CC2C(CCCC(C#N)(c3ccccc3)c3ccccc3)C2C1.[I-] |
| InChI | InChI=1S/C32H35N2O2.HI/c1-34(18-16-24-14-15-30-31(19-24)36-23-35-30)20-28-27(29(28)21-34)13-8-17-32(22-33,25-9-4-2-5-10-25)26-11-6-3-7-12-26;/h2-7,9-12,14-15,19,27-29H,8,13,16-18,20-21,23H2,1H3;1H/q+1;/p-1 |
| InChIKey | VQMYQVBJFPCVQF-UHFFFAOYSA-M |
| XLogP | 2.96 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|