C20H28O2S2 — CID 10451438
1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-benzylsulfanylethanone (PubChem CID 10451438) has the molecular formula C20H28O2S2 and a molecular weight of 364.58 g/mol. Its IUPAC name is 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-benzylsulfanylethanone.
| Compound Name | 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-benzylsulfanylethanone |
|---|---|
| PubChem CID | 10451438 |
| Molecular Formula | C20H28O2S2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-benzylsulfanylethanone |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](C(=O)CSCc1ccccc1)SC2(C)C |
| InChI | InChI=1S/C20H28O2S2/c1-14-9-10-16-18(11-14)22-19(24-20(16,2)3)17(21)13-23-12-15-7-5-4-6-8-15/h4-8,14,16,18-19H,9-13H2,1-3H3/t14-,16-,18-,19-/m1/s1 |
| InChIKey | FABCVBAOGWHWNW-YCEFEEMOSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |