C18H27OS+ — CID 10993891
(4aR,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-3-ium (PubChem CID 10993891) has the molecular formula C18H27OS+ and a molecular weight of 291.48 g/mol. Its IUPAC name is (4aR,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-3-ium.
| Compound Name | (4aR,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-3-ium |
|---|---|
| PubChem CID | 10993891 |
| Molecular Formula | C18H27OS+ |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (4aR,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-3-ium |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)OC[S+](Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C18H27OS/c1-14-9-10-16-17(11-14)19-13-20(18(16,2)3)12-15-7-5-4-6-8-15/h4-8,14,16-17H,9-13H2,1-3H3/q+1/t14-,16-,17-,20?/m1/s1 |
| InChIKey | BYVDAMZNRXSHPE-FIALEDGQSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|