C13H14N2O4S — CID 104520180
3-[5-(1,1-dioxothian-2-yl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 104520180) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[5-(1,1-dioxothian-2-yl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 3-[5-(1,1-dioxothian-2-yl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 104520180 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[5-(1,1-dioxothian-2-yl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | O=S1(=O)CCCCC1c1nc(-c2cccc(O)c2)no1 |
| InChI | InChI=1S/C13H14N2O4S/c16-10-5-3-4-9(8-10)12-14-13(19-15-12)11-6-1-2-7-20(11,17)18/h3-5,8,11,16H,1-2,6-7H2 |
| InChIKey | PXSTVNPCHNFTLK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |