C14H15ClN2O3S — CID 104522858
4-(3-chlorophenyl)-5-(1,1-dioxothian-2-yl)-1,2-oxazol-3-amine (PubChem CID 104522858) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-(1,1-dioxothian-2-yl)-1,2-oxazol-3-amine.
| Compound Name | 4-(3-chlorophenyl)-5-(1,1-dioxothian-2-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 104522858 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-(3-chlorophenyl)-5-(1,1-dioxothian-2-yl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(C2CCCCS2(=O)=O)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H15ClN2O3S/c15-10-5-3-4-9(8-10)12-13(20-17-14(12)16)11-6-1-2-7-21(11,18)19/h3-5,8,11H,1-2,6-7H2,(H2,16,17) |
| InChIKey | FSPHIQURORTYRE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |