C12H16BrNO2S — CID 104522965
2-(1-bromo-2-pyridin-4-ylethyl)thiane 1,1-dioxide (PubChem CID 104522965) has the molecular formula C12H16BrNO2S and a molecular weight of 318.24 g/mol. Its IUPAC name is 2-(1-bromo-2-pyridin-4-ylethyl)thiane 1,1-dioxide.
| Compound Name | 2-(1-bromo-2-pyridin-4-ylethyl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104522965 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 2-(1-bromo-2-pyridin-4-ylethyl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1C(Br)Cc1ccncc1 |
| InChI | InChI=1S/C12H16BrNO2S/c13-11(9-10-4-6-14-7-5-10)12-3-1-2-8-17(12,15)16/h4-7,11-12H,1-3,8-9H2 |
| InChIKey | PLAYCQOAUHDCLO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|