C14H15ClO — CID 104544423
5-(3-chlorocyclohexen-1-yl)-2,3-dihydro-1-benzofuran (PubChem CID 104544423) has the molecular formula C14H15ClO and a molecular weight of 234.73 g/mol. Its IUPAC name is 5-(3-chlorocyclohexen-1-yl)-2,3-dihydro-1-benzofuran.
| Compound Name | 5-(3-chlorocyclohexen-1-yl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104544423 |
| Molecular Formula | C14H15ClO |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 5-(3-chlorocyclohexen-1-yl)-2,3-dihydro-1-benzofuran |
| SMILES | ClC1C=C(c2ccc3c(c2)CCO3)CCC1 |
| InChI | InChI=1S/C14H15ClO/c15-13-3-1-2-10(9-13)11-4-5-14-12(8-11)6-7-16-14/h4-5,8-9,13H,1-3,6-7H2 |
| InChIKey | TUQMQTXBEKFWES-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|