C24H22ClNO4 — CID 10455003
6-(4-chlorophenyl)-3-hydroxy-3-methyl-N,6-diphenyldioxane-4-carboxamide (PubChem CID 10455003) has the molecular formula C24H22ClNO4 and a molecular weight of 423.90 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-hydroxy-3-methyl-N,6-diphenyldioxane-4-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-3-hydroxy-3-methyl-N,6-diphenyldioxane-4-carboxamide |
|---|---|
| PubChem CID | 10455003 |
| Molecular Formula | C24H22ClNO4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 6-(4-chlorophenyl)-3-hydroxy-3-methyl-N,6-diphenyldioxane-4-carboxamide |
| SMILES | CC1(O)OOC(c2ccccc2)(c2ccc(Cl)cc2)CC1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H22ClNO4/c1-23(28)21(22(27)26-20-10-6-3-7-11-20)16-24(30-29-23,17-8-4-2-5-9-17)18-12-14-19(25)15-13-18/h2-15,21,28H,16H2,1H3,(H,26,27) |
| InChIKey | HFLFJVUEKBYXGK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|