C13H11N3O2S2 — CID 104631686
4-(1,3-benzothiazol-2-ylmethylsulfonyl)pyridin-3-amine (PubChem CID 104631686) has the molecular formula C13H11N3O2S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylmethylsulfonyl)pyridin-3-amine.
| Compound Name | 4-(1,3-benzothiazol-2-ylmethylsulfonyl)pyridin-3-amine |
|---|---|
| PubChem CID | 104631686 |
| Molecular Formula | C13H11N3O2S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylmethylsulfonyl)pyridin-3-amine |
| SMILES | Nc1cnccc1S(=O)(=O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H11N3O2S2/c14-9-7-15-6-5-12(9)20(17,18)8-13-16-10-3-1-2-4-11(10)19-13/h1-7H,8,14H2 |
| InChIKey | YSEDVTDVOFGRDS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |