C20H18O10 — CID 10477106
(2R,3R)-3-[(E)-2-(3,4-dihydroxyphenyl)ethenoxy]carbonyl-2-hydroxy-2-[(4-hydroxyphenyl)methyl]butanedioic acid (PubChem CID 10477106) has the molecular formula C20H18O10 and a molecular weight of 418.35 g/mol. Its IUPAC name is (2R,3R)-3-[(E)-2-(3,4-dihydroxyphenyl)ethenoxy]carbonyl-2-hydroxy-2-[(4-hydroxyphenyl)methyl]butanedioic acid.
| Compound Name | (2R,3R)-3-[(E)-2-(3,4-dihydroxyphenyl)ethenoxy]carbonyl-2-hydroxy-2-[(4-hydroxyphenyl)methyl]butanedioic acid |
|---|---|
| PubChem CID | 10477106 |
| Molecular Formula | C20H18O10 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (2R,3R)-3-[(E)-2-(3,4-dihydroxyphenyl)ethenoxy]carbonyl-2-hydroxy-2-[(4-hydroxyphenyl)methyl]butanedioic acid |
| SMILES | O=C(O)[C@H](C(=O)O/C=C/c1ccc(O)c(O)c1)[C@](O)(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C20H18O10/c21-13-4-1-12(2-5-13)10-20(29,19(27)28)16(17(24)25)18(26)30-8-7-11-3-6-14(22)15(23)9-11/h1-9,16,21-23,29H,10H2,(H,24,25)(H,27,28)/b8-7+/t16-,20-/m1/s1 |
| InChIKey | HIAFNMMMFUCKFS-APJIANLZSA-N |
| XLogP | 1.08 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|