C10H2BrF13S — CID 10480326
3-bromo-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)thiophene (PubChem CID 10480326) has the molecular formula C10H2BrF13S and a molecular weight of 481.07 g/mol. Its IUPAC name is 3-bromo-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)thiophene.
| Compound Name | 3-bromo-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)thiophene |
|---|---|
| PubChem CID | 10480326 |
| Molecular Formula | C10H2BrF13S |
| Molecular Weight | 481.07 g/mol |
| Exact Mass | 479.89 |
| IUPAC Name | 3-bromo-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)thiophene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1sccc1Br |
| InChI | InChI=1S/C10H2BrF13S/c11-3-1-2-25-4(3)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)24/h1-2H |
| InChIKey | FPRHDAOLSDUERX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.07 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|