About CID 10486679
CID 10486679 (PubChem CID 10486679) has the molecular formula C18H14Mo2O2
and a molecular weight of 454.19 g/mol.
Molecular Properties
| Compound Name | CID 10486679 |
| PubChem CID | 10486679 |
| Molecular Formula | C18H14Mo2O2 |
| Molecular Weight | 454.19 g/mol |
| Exact Mass | 457.91 |
| IUPAC Name | — |
| SMILES | COc1ccc(/C(C#[Mo])=C(\C#[Mo])c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H14O2.2Mo/c1-13(15-5-9-17(19-3)10-6-15)14(2)16-7-11-18(20-4)12-8-16;;/h5-12H,3-4H3;;/b14-13+;; |
| InChIKey | IDGZSYPDJNLKEU-QDBORUFSSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 10486679 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10486679?
The IUPAC name of CID 10486679 (CID 10486679) is not available.
What is the SMILES notation for CID 10486679?
The canonical SMILES for CID 10486679 is COc1ccc(/C(C#[Mo])=C(\C#[Mo])c2ccc(OC)cc2)cc1.
What is the InChIKey of CID 10486679?
The InChIKey is IDGZSYPDJNLKEU-QDBORUFSSA-N. The full InChI is InChI=1S/C18H14O2.2Mo/c1-13(15-5-9-17(19-3)10-6-15)14(2)16-7-11-18(20-4)12-8-16;;/h5-12H,3-4H3;;/b14-13+;;.
What are the key properties of CID 10486679?
CID 10486679 has a molecular weight of 454.19 g/mol, XLogP of 3.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10486679 is sourced from PubChem (CID 10486679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).