C9H17N3 — CID 10487285
cis-(3S,5R)-1-azido-1,3,5-trimethylcyclohexane (PubChem CID 10487285) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is cis-(3S,5R)-1-azido-1,3,5-trimethylcyclohexane.
| Compound Name | cis-(3S,5R)-1-azido-1,3,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 10487285 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | cis-(3S,5R)-1-azido-1,3,5-trimethylcyclohexane |
| SMILES | C[C@@H]1C[C@H](C)CC(C)(N=[N+]=[N-])C1 |
| InChI | InChI=1S/C9H17N3/c1-7-4-8(2)6-9(3,5-7)11-12-10/h7-8H,4-6H2,1-3H3/t7-,8+,9? |
| InChIKey | FJHRUQMFTRMSFC-JVHMLUBASA-N |
| XLogP | 3.51 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|