C10H16N2O4 — CID 10489524
2-amino-3-(5-butyl-3-oxo-1,2-oxazol-4-yl)propanoic acid (PubChem CID 10489524) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-amino-3-(5-butyl-3-oxo-1,2-oxazol-4-yl)propanoic acid.
| Compound Name | 2-amino-3-(5-butyl-3-oxo-1,2-oxazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 10489524 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-amino-3-(5-butyl-3-oxo-1,2-oxazol-4-yl)propanoic acid |
| SMILES | CCCCc1o[nH]c(=O)c1CC(N)C(=O)O |
| InChI | InChI=1S/C10H16N2O4/c1-2-3-4-8-6(9(13)12-16-8)5-7(11)10(14)15/h7H,2-5,11H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | BHLLBRLRDRZYJZ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |